C5H9O6- — CID 5460056
(2R,3S,4R)-2,3,4,5-tetrahydroxypentanoate (PubChem CID 5460056) has the molecular formula C5H9O6- and a molecular weight of 165.12 g/mol. Its IUPAC name is (2R,3S,4R)-2,3,4,5-tetrahydroxypentanoate.
| Compound Name | (2R,3S,4R)-2,3,4,5-tetrahydroxypentanoate |
|---|---|
| PubChem CID | 5460056 |
| Molecular Formula | C5H9O6- |
| Molecular Weight | 165.12 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | (2R,3S,4R)-2,3,4,5-tetrahydroxypentanoate |
| SMILES | O=C([O-])[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C5H10O6/c6-1-2(7)3(8)4(9)5(10)11/h2-4,6-9H,1H2,(H,10,11)/p-1/t2-,3+,4-/m1/s1 |
| InChIKey | QXKAIJAYHKCRRA-FLRLBIABSA-M |
| XLogP | -4.19 |
| TPSA | 121.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.12 |
| LogP ≤ 5 | -4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |