C5H9KO6 — CID 23666384
potassium (2S,3S,4R)-2,3,4,5-tetrahydroxypentanoate (PubChem CID 23666384) has the molecular formula C5H9KO6 and a molecular weight of 204.22 g/mol. Its IUPAC name is potassium (2S,3S,4R)-2,3,4,5-tetrahydroxypentanoate.
| Compound Name | potassium (2S,3S,4R)-2,3,4,5-tetrahydroxypentanoate |
|---|---|
| PubChem CID | 23666384 |
| Molecular Formula | C5H9KO6 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.00 |
| IUPAC Name | potassium (2S,3S,4R)-2,3,4,5-tetrahydroxypentanoate |
| SMILES | O=C([O-])[C@@H](O)[C@@H](O)[C@H](O)CO.[K+] |
| InChI | InChI=1S/C5H10O6.K/c6-1-2(7)3(8)4(9)5(10)11;/h2-4,6-9H,1H2,(H,10,11);/q;+1/p-1/t2-,3+,4+;/m1./s1 |
| InChIKey | HSMKJRYJAZFMNP-VGFCZBDGSA-M |
| XLogP | -7.18 |
| TPSA | 121.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | -7.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |