C10H18CaO12 — CID 78759326
calcium;(2S,3R,4S)-2,3,4,5-tetrahydroxypentanoate;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanoate (PubChem CID 78759326) has the molecular formula C10H18CaO12 and a molecular weight of 370.32 g/mol. Its IUPAC name is calcium;(2S,3R,4S)-2,3,4,5-tetrahydroxypentanoate;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanoate.
| Compound Name | calcium;(2S,3R,4S)-2,3,4,5-tetrahydroxypentanoate;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanoate |
|---|---|
| PubChem CID | 78759326 |
| Molecular Formula | C10H18CaO12 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | calcium;(2S,3R,4S)-2,3,4,5-tetrahydroxypentanoate;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanoate |
| SMILES | O=C([O-])[C@@H](O)[C@H](O)[C@@H](O)CO.O=C([O-])[C@@H](O)[C@H](O)[C@H](O)CO.[Ca+2] |
| InChI | InChI=1S/2C5H10O6.Ca/c2*6-1-2(7)3(8)4(9)5(10)11;/h2*2-4,6-9H,1H2,(H,10,11);/q;;+2/p-2/t2-,3+,4-;2-,3-,4+;/m01./s1 |
| InChIKey | XAHGBSMZOUCKFJ-QCQJDKNSSA-L |
| XLogP | -8.76 |
| TPSA | 242.10 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | -8.76 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |