C10H20O9 — CID 56619103
(2S,3R,4S,6S,7S,8R,9R)-1,2,3,4,6,7,8,9-octahydroxydecan-5-one (PubChem CID 56619103) has the molecular formula C10H20O9 and a molecular weight of 284.26 g/mol. Its IUPAC name is (2S,3R,4S,6S,7S,8R,9R)-1,2,3,4,6,7,8,9-octahydroxydecan-5-one.
| Compound Name | (2S,3R,4S,6S,7S,8R,9R)-1,2,3,4,6,7,8,9-octahydroxydecan-5-one |
|---|---|
| PubChem CID | 56619103 |
| Molecular Formula | C10H20O9 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | (2S,3R,4S,6S,7S,8R,9R)-1,2,3,4,6,7,8,9-octahydroxydecan-5-one |
| SMILES | C[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)C(=O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C10H20O9/c1-3(12)5(14)7(16)9(18)10(19)8(17)6(15)4(13)2-11/h3-9,11-18H,2H2,1H3/t3-,4+,5-,6-,7+,8+,9+/m1/s1 |
| InChIKey | IWVGVRYMNNLIKH-LFKQKWFHSA-N |
| XLogP | -4.91 |
| TPSA | 178.91 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | -4.91 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |