C9H18O6 — CID 139765414
(4R,5S,6S,7R)-4,5,6,7,8-pentahydroxy-2-methyloctan-3-one (PubChem CID 139765414) has the molecular formula C9H18O6 and a molecular weight of 222.24 g/mol. Its IUPAC name is (4R,5S,6S,7R)-4,5,6,7,8-pentahydroxy-2-methyloctan-3-one.
| Compound Name | (4R,5S,6S,7R)-4,5,6,7,8-pentahydroxy-2-methyloctan-3-one |
|---|---|
| PubChem CID | 139765414 |
| Molecular Formula | C9H18O6 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | (4R,5S,6S,7R)-4,5,6,7,8-pentahydroxy-2-methyloctan-3-one |
| SMILES | CC(C)C(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H18O6/c1-4(2)6(12)8(14)9(15)7(13)5(11)3-10/h4-5,7-11,13-15H,3H2,1-2H3/t5-,7+,8+,9+/m1/s1 |
| InChIKey | QTJFTLJIUHROMP-WOPDXLMNSA-N |
| XLogP | -2.35 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -2.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |