C14H28O13 — CID 54524447
(2S,3R,4R,5S,6R,8S,9R,10R,11S,12R,13R)-1,2,3,4,5,6,8,9,10,11,12,13-dodecahydroxytetradecan-7-one (PubChem CID 54524447) has the molecular formula C14H28O13 and a molecular weight of 404.37 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R,8S,9R,10R,11S,12R,13R)-1,2,3,4,5,6,8,9,10,11,12,13-dodecahydroxytetradecan-7-one.
| Compound Name | (2S,3R,4R,5S,6R,8S,9R,10R,11S,12R,13R)-1,2,3,4,5,6,8,9,10,11,12,13-dodecahydroxytetradecan-7-one |
|---|---|
| PubChem CID | 54524447 |
| Molecular Formula | C14H28O13 |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | (2S,3R,4R,5S,6R,8S,9R,10R,11S,12R,13R)-1,2,3,4,5,6,8,9,10,11,12,13-dodecahydroxytetradecan-7-one |
| SMILES | C[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C14H28O13/c1-3(16)5(18)7(20)9(22)11(24)13(26)14(27)12(25)10(23)8(21)6(19)4(17)2-15/h3-13,15-26H,2H2,1H3/t3-,4+,5-,6-,7+,8-,9-,10+,11-,12-,13+/m1/s1 |
| InChIKey | YSDKCAILMVMNBU-JUFHLJPJSA-N |
| XLogP | -7.46 |
| TPSA | 259.83 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | -7.46 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 13 |