C8H16O6 — CID 141162248
(5R,6S,7R)-3,5,6,7,8-pentahydroxyoctan-4-one (PubChem CID 141162248) has the molecular formula C8H16O6 and a molecular weight of 208.21 g/mol. Its IUPAC name is (5R,6S,7R)-3,5,6,7,8-pentahydroxyoctan-4-one.
| Compound Name | (5R,6S,7R)-3,5,6,7,8-pentahydroxyoctan-4-one |
|---|---|
| PubChem CID | 141162248 |
| Molecular Formula | C8H16O6 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | (5R,6S,7R)-3,5,6,7,8-pentahydroxyoctan-4-one |
| SMILES | CCC(O)C(=O)[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H16O6/c1-2-4(10)6(12)8(14)7(13)5(11)3-9/h4-5,7-11,13-14H,2-3H2,1H3/t4?,5-,7+,8+/m1/s1 |
| InChIKey | ZDGLJWKFSUNQQE-QIOPAJBRSA-N |
| XLogP | -2.60 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |