C8H16O7 — CID 141107730
(3R,4S,5R)-1-ethoxy-1,3,4,5,6-pentahydroxyhexan-2-one (PubChem CID 141107730) has the molecular formula C8H16O7 and a molecular weight of 224.21 g/mol. Its IUPAC name is (3R,4S,5R)-1-ethoxy-1,3,4,5,6-pentahydroxyhexan-2-one.
| Compound Name | (3R,4S,5R)-1-ethoxy-1,3,4,5,6-pentahydroxyhexan-2-one |
|---|---|
| PubChem CID | 141107730 |
| Molecular Formula | C8H16O7 |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | (3R,4S,5R)-1-ethoxy-1,3,4,5,6-pentahydroxyhexan-2-one |
| SMILES | CCOC(O)C(=O)[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H16O7/c1-2-15-8(14)7(13)6(12)5(11)4(10)3-9/h4-6,8-12,14H,2-3H2,1H3/t4-,5+,6-,8?/m1/s1 |
| InChIKey | XZRKGZYOYCAERD-NFRNADEISA-N |
| XLogP | -3.01 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|