C6H14O5 — CID 89316162
(1R,2S)-1-ethoxybutane-1,2,3,4-tetrol (PubChem CID 89316162) has the molecular formula C6H14O5 and a molecular weight of 166.17 g/mol. Its IUPAC name is (1R,2S)-1-ethoxybutane-1,2,3,4-tetrol.
| Compound Name | (1R,2S)-1-ethoxybutane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 89316162 |
| Molecular Formula | C6H14O5 |
| Molecular Weight | 166.17 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | (1R,2S)-1-ethoxybutane-1,2,3,4-tetrol |
| SMILES | CCO[C@@H](O)[C@@H](O)C(O)CO |
| InChI | InChI=1S/C6H14O5/c1-2-11-6(10)5(9)4(8)3-7/h4-10H,2-3H2,1H3/t4?,5-,6+/m0/s1 |
| InChIKey | YKDXWVQVPBBWDA-DUAGOPDLSA-N |
| XLogP | -1.94 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.17 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|