C8H18O7 — CID 141446098
(2R,3R,4R)-1-(2-methoxyethoxy)pentane-1,2,3,4,5-pentol (PubChem CID 141446098) has the molecular formula C8H18O7 and a molecular weight of 226.22 g/mol. Its IUPAC name is (2R,3R,4R)-1-(2-methoxyethoxy)pentane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R)-1-(2-methoxyethoxy)pentane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 141446098 |
| Molecular Formula | C8H18O7 |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | (2R,3R,4R)-1-(2-methoxyethoxy)pentane-1,2,3,4,5-pentol |
| SMILES | COCCOC(O)[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H18O7/c1-14-2-3-15-8(13)7(12)6(11)5(10)4-9/h5-13H,2-4H2,1H3/t5-,6-,7-,8?/m1/s1 |
| InChIKey | OWLMLQXOVMDJGR-XDTPYFJJSA-N |
| XLogP | -2.96 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|