C12H26O8 — CID 155319585
1,2-bis[2-(2-methoxyethoxy)ethoxy]ethane-1,2-diol (PubChem CID 155319585) has the molecular formula C12H26O8 and a molecular weight of 298.33 g/mol. Its IUPAC name is 1,2-bis[2-(2-methoxyethoxy)ethoxy]ethane-1,2-diol.
| Compound Name | 1,2-bis[2-(2-methoxyethoxy)ethoxy]ethane-1,2-diol |
|---|---|
| PubChem CID | 155319585 |
| Molecular Formula | C12H26O8 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 1,2-bis[2-(2-methoxyethoxy)ethoxy]ethane-1,2-diol |
| SMILES | COCCOCCOC(O)C(O)OCCOCCOC |
| InChI | InChI=1S/C12H26O8/c1-15-3-5-17-7-9-19-11(13)12(14)20-10-8-18-6-4-16-2/h11-14H,3-10H2,1-2H3 |
| InChIKey | PZOLCHOZUHRTIU-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|