C12H22O9 — CID 90913494
2-(2-methoxyethoxy)-3-[2-(2-methoxyethoxy)ethoxy]butanedioic acid (PubChem CID 90913494) has the molecular formula C12H22O9 and a molecular weight of 310.30 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-3-[2-(2-methoxyethoxy)ethoxy]butanedioic acid.
| Compound Name | 2-(2-methoxyethoxy)-3-[2-(2-methoxyethoxy)ethoxy]butanedioic acid |
|---|---|
| PubChem CID | 90913494 |
| Molecular Formula | C12H22O9 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-(2-methoxyethoxy)-3-[2-(2-methoxyethoxy)ethoxy]butanedioic acid |
| SMILES | COCCOCCOC(C(=O)O)C(OCCOC)C(=O)O |
| InChI | InChI=1S/C12H22O9/c1-17-3-5-19-6-8-21-10(12(15)16)9(11(13)14)20-7-4-18-2/h9-10H,3-8H2,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | ODQVEQDLNOGTKP-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|