C8H15O5- — CID 18318699
2-[2-(2-methoxyethoxy)ethoxy]propanoate (PubChem CID 18318699) has the molecular formula C8H15O5- and a molecular weight of 191.20 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]propanoate.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]propanoate |
|---|---|
| PubChem CID | 18318699 |
| Molecular Formula | C8H15O5- |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]propanoate |
| SMILES | COCCOCCOC(C)C(=O)[O-] |
| InChI | InChI=1S/C8H16O5/c1-7(8(9)10)13-6-5-12-4-3-11-2/h7H,3-6H2,1-2H3,(H,9,10)/p-1 |
| InChIKey | ICUQKOOCTBJFHS-UHFFFAOYSA-M |
| XLogP | -1.20 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|