C8H19NO3 — CID 102416894
(2S)-2-[2-(2-methoxyethoxy)ethoxy]propan-1-amine (PubChem CID 102416894) has the molecular formula C8H19NO3 and a molecular weight of 177.24 g/mol. Its IUPAC name is (2S)-2-[2-(2-methoxyethoxy)ethoxy]propan-1-amine.
| Compound Name | (2S)-2-[2-(2-methoxyethoxy)ethoxy]propan-1-amine |
|---|---|
| PubChem CID | 102416894 |
| Molecular Formula | C8H19NO3 |
| Molecular Weight | 177.24 g/mol |
| Exact Mass | 177.14 |
| IUPAC Name | (2S)-2-[2-(2-methoxyethoxy)ethoxy]propan-1-amine |
| SMILES | COCCOCCO[C@@H](C)CN |
| InChI | InChI=1S/C8H19NO3/c1-8(7-9)12-6-5-11-4-3-10-2/h8H,3-7,9H2,1-2H3/t8-/m0/s1 |
| InChIKey | XXEJNINSPKLXIG-QMMMGPOBSA-N |
| XLogP | 0.01 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.24 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|