C9H17O5- — CID 140579321
(2S)-3-[2-(2-methoxyethoxy)ethoxy]-2-methylpropanoate (PubChem CID 140579321) has the molecular formula C9H17O5- and a molecular weight of 205.23 g/mol. Its IUPAC name is (2S)-3-[2-(2-methoxyethoxy)ethoxy]-2-methylpropanoate.
| Compound Name | (2S)-3-[2-(2-methoxyethoxy)ethoxy]-2-methylpropanoate |
|---|---|
| PubChem CID | 140579321 |
| Molecular Formula | C9H17O5- |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (2S)-3-[2-(2-methoxyethoxy)ethoxy]-2-methylpropanoate |
| SMILES | COCCOCCOC[C@H](C)C(=O)[O-] |
| InChI | InChI=1S/C9H18O5/c1-8(9(10)11)7-14-6-5-13-4-3-12-2/h8H,3-7H2,1-2H3,(H,10,11)/p-1/t8-/m0/s1 |
| InChIKey | IEVKBJWWIATDRD-QMMMGPOBSA-M |
| XLogP | -0.95 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|