C11H23NO6 — CID 104565015
3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-(methylamino)propanoic acid (PubChem CID 104565015) has the molecular formula C11H23NO6 and a molecular weight of 265.31 g/mol. Its IUPAC name is 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-(methylamino)propanoic acid.
| Compound Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-(methylamino)propanoic acid |
|---|---|
| PubChem CID | 104565015 |
| Molecular Formula | C11H23NO6 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-(methylamino)propanoic acid |
| SMILES | CNC(COCCOCCOCCOC)C(=O)O |
| InChI | InChI=1S/C11H23NO6/c1-12-10(11(13)14)9-18-8-7-17-6-5-16-4-3-15-2/h10,12H,3-9H2,1-2H3,(H,13,14) |
| InChIKey | MLLKOYTYUKXFNO-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|