C7H16ClNO4 — CID 170898246
(2S)-3-[(2S)-2-hydroxypropoxy]-2-(methylamino)propanoic acid;hydrochloride (PubChem CID 170898246) has the molecular formula C7H16ClNO4 and a molecular weight of 213.66 g/mol. Its IUPAC name is (2S)-3-[(2S)-2-hydroxypropoxy]-2-(methylamino)propanoic acid;hydrochloride.
| Compound Name | (2S)-3-[(2S)-2-hydroxypropoxy]-2-(methylamino)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 170898246 |
| Molecular Formula | C7H16ClNO4 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | (2S)-3-[(2S)-2-hydroxypropoxy]-2-(methylamino)propanoic acid;hydrochloride |
| SMILES | CN[C@@H](COC[C@H](C)O)C(=O)O.Cl |
| InChI | InChI=1S/C7H15NO4.ClH/c1-5(9)3-12-4-6(8-2)7(10)11;/h5-6,8-9H,3-4H2,1-2H3,(H,10,11);1H/t5-,6-;/m0./s1 |
| InChIKey | IOIBLRJXZSXIKL-GEMLJDPKSA-N |
| XLogP | -0.52 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |