About propanoic acid;1-propoxypropan-2-ol
propanoic acid;1-propoxypropan-2-ol (PubChem CID 87505048) has the molecular formula C9H20O4
and a molecular weight of 192.25 g/mol. Its IUPAC name is propanoic acid;1-propoxypropan-2-ol.
Molecular Properties
| Compound Name | propanoic acid;1-propoxypropan-2-ol |
| PubChem CID | 87505048 |
| Molecular Formula | C9H20O4 |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | propanoic acid;1-propoxypropan-2-ol |
| SMILES | CCC(=O)O.CCCOCC(C)O |
| InChI | InChI=1S/C6H14O2.C3H6O2/c1-3-4-8-5-6(2)7;1-2-3(4)5/h6-7H,3-5H2,1-2H3;2H2,1H3,(H,4,5) |
| InChIKey | GLACHQINNNKHJR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze propanoic acid;1-propoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoic acid;1-propoxypropan-2-ol?
The IUPAC name of propanoic acid;1-propoxypropan-2-ol (CID 87505048) is propanoic acid;1-propoxypropan-2-ol.
What is the SMILES notation for propanoic acid;1-propoxypropan-2-ol?
The canonical SMILES for propanoic acid;1-propoxypropan-2-ol is CCC(=O)O.CCCOCC(C)O.
What is the InChIKey of propanoic acid;1-propoxypropan-2-ol?
The InChIKey is GLACHQINNNKHJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2.C3H6O2/c1-3-4-8-5-6(2)7;1-2-3(4)5/h6-7H,3-5H2,1-2H3;2H2,1H3,(H,4,5).
What are the key properties of propanoic acid;1-propoxypropan-2-ol?
propanoic acid;1-propoxypropan-2-ol has a molecular weight of 192.25 g/mol, XLogP of 1.27, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propanoic acid;1-propoxypropan-2-ol is sourced from PubChem (CID 87505048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).