C10H22NO4+ — CID 21014970
carboxymethyl-(2-hydroxy-3-propoxypropyl)-dimethylazanium (PubChem CID 21014970) has the molecular formula C10H22NO4+ and a molecular weight of 220.29 g/mol. Its IUPAC name is carboxymethyl-(2-hydroxy-3-propoxypropyl)-dimethylazanium.
| Compound Name | carboxymethyl-(2-hydroxy-3-propoxypropyl)-dimethylazanium |
|---|---|
| PubChem CID | 21014970 |
| Molecular Formula | C10H22NO4+ |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | carboxymethyl-(2-hydroxy-3-propoxypropyl)-dimethylazanium |
| SMILES | CCCOCC(O)C[N+](C)(C)CC(=O)O |
| InChI | InChI=1S/C10H21NO4/c1-4-5-15-8-9(12)6-11(2,3)7-10(13)14/h9,12H,4-8H2,1-3H3/p+1 |
| InChIKey | KCFZTZSNHOAARA-UHFFFAOYSA-O |
| XLogP | -0.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|