C7H15ClNO3+ — CID 19797980
carboxymethyl-(3-chloro-2-hydroxypropyl)-dimethylazanium (PubChem CID 19797980) has the molecular formula C7H15ClNO3+ and a molecular weight of 196.65 g/mol. Its IUPAC name is carboxymethyl-(3-chloro-2-hydroxypropyl)-dimethylazanium.
| Compound Name | carboxymethyl-(3-chloro-2-hydroxypropyl)-dimethylazanium |
|---|---|
| PubChem CID | 19797980 |
| Molecular Formula | C7H15ClNO3+ |
| Molecular Weight | 196.65 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | carboxymethyl-(3-chloro-2-hydroxypropyl)-dimethylazanium |
| SMILES | C[N+](C)(CC(=O)O)CC(O)CCl |
| InChI | InChI=1S/C7H14ClNO3/c1-9(2,5-7(11)12)4-6(10)3-8/h6,10H,3-5H2,1-2H3/p+1 |
| InChIKey | LEQBDDDZBQPOAY-UHFFFAOYSA-O |
| XLogP | -0.25 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.65 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|