C9H12F8NO2+ — CID 165364685
carboxymethyl-dimethyl-(2,3,3,4,4,5,5,5-octafluoropentyl)azanium (PubChem CID 165364685) has the molecular formula C9H12F8NO2+ and a molecular weight of 318.18 g/mol. Its IUPAC name is carboxymethyl-dimethyl-(2,3,3,4,4,5,5,5-octafluoropentyl)azanium.
| Compound Name | carboxymethyl-dimethyl-(2,3,3,4,4,5,5,5-octafluoropentyl)azanium |
|---|---|
| PubChem CID | 165364685 |
| Molecular Formula | C9H12F8NO2+ |
| Molecular Weight | 318.18 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | carboxymethyl-dimethyl-(2,3,3,4,4,5,5,5-octafluoropentyl)azanium |
| SMILES | C[N+](C)(CC(=O)O)CC(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H11F8NO2/c1-18(2,4-6(19)20)3-5(10)7(11,12)8(13,14)9(15,16)17/h5H,3-4H2,1-2H3/p+1 |
| InChIKey | JEOLNDWWGQDWEU-UHFFFAOYSA-O |
| XLogP | 2.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.18 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|