C8H6F8O2 — CID 89253061
4,5,5,6,6,7,7,7-octafluoro-2-methylideneheptanoic acid (PubChem CID 89253061) has the molecular formula C8H6F8O2 and a molecular weight of 286.12 g/mol. Its IUPAC name is 4,5,5,6,6,7,7,7-octafluoro-2-methylideneheptanoic acid.
| Compound Name | 4,5,5,6,6,7,7,7-octafluoro-2-methylideneheptanoic acid |
|---|---|
| PubChem CID | 89253061 |
| Molecular Formula | C8H6F8O2 |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 4,5,5,6,6,7,7,7-octafluoro-2-methylideneheptanoic acid |
| SMILES | C=C(CC(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C8H6F8O2/c1-3(5(17)18)2-4(9)6(10,11)7(12,13)8(14,15)16/h4H,1-2H2,(H,17,18) |
| InChIKey | NGAUSWKJHYGQMQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|