C13H12F12O3 — CID 175200774
6,6,7,7,8,8,9,9,10,11,11,11-dodecafluoro-4-hydroxy-10-methyl-2-methylideneundecanoic acid (PubChem CID 175200774) has the molecular formula C13H12F12O3 and a molecular weight of 444.21 g/mol. Its IUPAC name is 6,6,7,7,8,8,9,9,10,11,11,11-dodecafluoro-4-hydroxy-10-methyl-2-methylideneundecanoic acid.
| Compound Name | 6,6,7,7,8,8,9,9,10,11,11,11-dodecafluoro-4-hydroxy-10-methyl-2-methylideneundecanoic acid |
|---|---|
| PubChem CID | 175200774 |
| Molecular Formula | C13H12F12O3 |
| Molecular Weight | 444.21 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 6,6,7,7,8,8,9,9,10,11,11,11-dodecafluoro-4-hydroxy-10-methyl-2-methylideneundecanoic acid |
| SMILES | C=C(CC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C13H12F12O3/c1-5(7(27)28)3-6(26)4-9(15,16)11(19,20)12(21,22)10(17,18)8(2,14)13(23,24)25/h6,26H,1,3-4H2,2H3,(H,27,28) |
| InChIKey | VVEBNPKYMGRULT-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.21 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|