C17H17F15O3 — CID 23539943
(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-2-hydroxydecyl) 3,3-dimethyl-2-methylidenebutanoate (PubChem CID 23539943) has the molecular formula C17H17F15O3 and a molecular weight of 554.29 g/mol. Its IUPAC name is (4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-2-hydroxydecyl) 3,3-dimethyl-2-methylidenebutanoate.
| Compound Name | (4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-2-hydroxydecyl) 3,3-dimethyl-2-methylidenebutanoate |
|---|---|
| PubChem CID | 23539943 |
| Molecular Formula | C17H17F15O3 |
| Molecular Weight | 554.29 g/mol |
| Exact Mass | 554.09 |
| IUPAC Name | (4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluoro-2-hydroxydecyl) 3,3-dimethyl-2-methylidenebutanoate |
| SMILES | C=C(C(=O)OCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C17H17F15O3/c1-7(10(2,3)4)9(34)35-6-8(33)5-11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)16(28,29)17(30,31)32/h8,33H,1,5-6H2,2-4H3 |
| InChIKey | NBTATSVBWAVCNM-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.29 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|