C13H15F9O4 — CID 102428034
2-(4,4,5,5,6,6,7,7,7-nonafluoro-2-hydroxyheptoxy)ethyl 2-methylprop-2-enoate (PubChem CID 102428034) has the molecular formula C13H15F9O4 and a molecular weight of 406.24 g/mol. Its IUPAC name is 2-(4,4,5,5,6,6,7,7,7-nonafluoro-2-hydroxyheptoxy)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(4,4,5,5,6,6,7,7,7-nonafluoro-2-hydroxyheptoxy)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102428034 |
| Molecular Formula | C13H15F9O4 |
| Molecular Weight | 406.24 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 2-(4,4,5,5,6,6,7,7,7-nonafluoro-2-hydroxyheptoxy)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H15F9O4/c1-7(2)9(24)26-4-3-25-6-8(23)5-10(14,15)11(16,17)12(18,19)13(20,21)22/h8,23H,1,3-6H2,2H3 |
| InChIKey | BNRIGEIQIGBQQF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|