C11H12F8O3 — CID 139918530
(4,4,5,5,6,6,7,7-octafluoro-2-hydroxyheptyl) 2-methylprop-2-enoate (PubChem CID 139918530) has the molecular formula C11H12F8O3 and a molecular weight of 344.20 g/mol. Its IUPAC name is (4,4,5,5,6,6,7,7-octafluoro-2-hydroxyheptyl) 2-methylprop-2-enoate.
| Compound Name | (4,4,5,5,6,6,7,7-octafluoro-2-hydroxyheptyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139918530 |
| Molecular Formula | C11H12F8O3 |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | (4,4,5,5,6,6,7,7-octafluoro-2-hydroxyheptyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H12F8O3/c1-5(2)7(21)22-4-6(20)3-9(14,15)11(18,19)10(16,17)8(12)13/h6,8,20H,1,3-4H2,2H3 |
| InChIKey | YXLBQTKWDWGECU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|