C11H10F10O2 — CID 18477233
2,3,3,4,5,5,6,6,7,7-decafluoroheptyl 2-methylprop-2-enoate (PubChem CID 18477233) has the molecular formula C11H10F10O2 and a molecular weight of 364.18 g/mol. Its IUPAC name is 2,3,3,4,5,5,6,6,7,7-decafluoroheptyl 2-methylprop-2-enoate.
| Compound Name | 2,3,3,4,5,5,6,6,7,7-decafluoroheptyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 18477233 |
| Molecular Formula | C11H10F10O2 |
| Molecular Weight | 364.18 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 2,3,3,4,5,5,6,6,7,7-decafluoroheptyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(F)C(F)(F)C(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H10F10O2/c1-4(2)6(22)23-3-5(12)9(16,17)7(13)10(18,19)11(20,21)8(14)15/h5,7-8H,1,3H2,2H3 |
| InChIKey | XUAPSBTYPRYIJE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.18 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|