C9H11F3O4 — CID 167048616
4,4,4-trifluoro-3-(2-methylprop-2-enoyloxymethyl)butanoic acid (PubChem CID 167048616) has the molecular formula C9H11F3O4 and a molecular weight of 240.18 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-(2-methylprop-2-enoyloxymethyl)butanoic acid.
| Compound Name | 4,4,4-trifluoro-3-(2-methylprop-2-enoyloxymethyl)butanoic acid |
|---|---|
| PubChem CID | 167048616 |
| Molecular Formula | C9H11F3O4 |
| Molecular Weight | 240.18 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 4,4,4-trifluoro-3-(2-methylprop-2-enoyloxymethyl)butanoic acid |
| SMILES | C=C(C)C(=O)OCC(CC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C9H11F3O4/c1-5(2)8(15)16-4-6(3-7(13)14)9(10,11)12/h6H,1,3-4H2,2H3,(H,13,14) |
| InChIKey | OWYDYWZWTMLNDE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.18 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|