C11H9F11O2 — CID 102083174
[3,3,4,4,4-pentafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)butyl] 2-methylprop-2-enoate (PubChem CID 102083174) has the molecular formula C11H9F11O2 and a molecular weight of 382.17 g/mol. Its IUPAC name is [3,3,4,4,4-pentafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)butyl] 2-methylprop-2-enoate.
| Compound Name | [3,3,4,4,4-pentafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)butyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102083174 |
| Molecular Formula | C11H9F11O2 |
| Molecular Weight | 382.17 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | [3,3,4,4,4-pentafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yl)butyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H9F11O2/c1-4(2)7(23)24-3-5(8(12,13)11(20,21)22)6(9(14,15)16)10(17,18)19/h5-6H,1,3H2,2H3 |
| InChIKey | FTXISTFFEAAVOL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.17 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|