About ethane;(3-hydroxy-2-methylpropyl) 2-methylprop-2-enoate
ethane;(3-hydroxy-2-methylpropyl) 2-methylprop-2-enoate (PubChem CID 171797944) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is ethane;(3-hydroxy-2-methylpropyl) 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | ethane;(3-hydroxy-2-methylpropyl) 2-methylprop-2-enoate |
| PubChem CID | 171797944 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | ethane;(3-hydroxy-2-methylpropyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)CO.CC |
| InChI | InChI=1S/C8H14O3.C2H6/c1-6(2)8(10)11-5-7(3)4-9;1-2/h7,9H,1,4-5H2,2-3H3;1-2H3 |
| InChIKey | PJFXPTDURUDNIF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(3-hydroxy-2-methylpropyl) 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3-hydroxy-2-methylpropyl) 2-methylprop-2-enoate?
The IUPAC name of ethane;(3-hydroxy-2-methylpropyl) 2-methylprop-2-enoate (CID 171797944) is ethane;(3-hydroxy-2-methylpropyl) 2-methylprop-2-enoate.
What is the SMILES notation for ethane;(3-hydroxy-2-methylpropyl) 2-methylprop-2-enoate?
The canonical SMILES for ethane;(3-hydroxy-2-methylpropyl) 2-methylprop-2-enoate is C=C(C)C(=O)OCC(C)CO.CC.
What is the InChIKey of ethane;(3-hydroxy-2-methylpropyl) 2-methylprop-2-enoate?
The InChIKey is PJFXPTDURUDNIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3.C2H6/c1-6(2)8(10)11-5-7(3)4-9;1-2/h7,9H,1,4-5H2,2-3H3;1-2H3.
What are the key properties of ethane;(3-hydroxy-2-methylpropyl) 2-methylprop-2-enoate?
ethane;(3-hydroxy-2-methylpropyl) 2-methylprop-2-enoate has a molecular weight of 188.27 g/mol, XLogP of 1.76, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3-hydroxy-2-methylpropyl) 2-methylprop-2-enoate is sourced from PubChem (CID 171797944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).