C21H36O4 — CID 175542458
[2,7,9-trimethyl-10-(2-methylprop-2-enoyloxy)decyl] 2-methylprop-2-enoate (PubChem CID 175542458) has the molecular formula C21H36O4 and a molecular weight of 352.52 g/mol. Its IUPAC name is [2,7,9-trimethyl-10-(2-methylprop-2-enoyloxy)decyl] 2-methylprop-2-enoate.
| Compound Name | [2,7,9-trimethyl-10-(2-methylprop-2-enoyloxy)decyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175542458 |
| Molecular Formula | C21H36O4 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | [2,7,9-trimethyl-10-(2-methylprop-2-enoyloxy)decyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)CCCCC(C)CC(C)COC(=O)C(=C)C |
| InChI | InChI=1S/C21H36O4/c1-15(2)20(22)24-13-18(6)11-9-8-10-17(5)12-19(7)14-25-21(23)16(3)4/h17-19H,1,3,8-14H2,2,4-7H3 |
| InChIKey | APUOUTADUNTGOR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|