C21H40O2 — CID 140601644
3-methylhexadecyl 2-methylprop-2-enoate (PubChem CID 140601644) has the molecular formula C21H40O2 and a molecular weight of 324.55 g/mol. Its IUPAC name is 3-methylhexadecyl 2-methylprop-2-enoate.
| Compound Name | 3-methylhexadecyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140601644 |
| Molecular Formula | C21H40O2 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.30 |
| IUPAC Name | 3-methylhexadecyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(C)CCCCCCCCCCCCC |
| InChI | InChI=1S/C21H40O2/c1-5-6-7-8-9-10-11-12-13-14-15-16-20(4)17-18-23-21(22)19(2)3/h20H,2,5-18H2,1,3-4H3 |
| InChIKey | WDNVGERFGOTUMM-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|