C57H90N6O12 — CID 88758316
[4-[[4,6-bis[bis[3-methyl-4-(2-methylprop-2-enoyloxy)butyl]amino]-1,3,5-triazin-2-yl]-[3-methyl-4-(2-methylprop-2-enoyloxy)butyl]amino]-2-methylbutyl] 2-methylprop-2-enoate (PubChem CID 88758316) has the molecular formula C57H90N6O12 and a molecular weight of 1051.38 g/mol. Its IUPAC name is [4-[[4,6-bis[bis[3-methyl-4-(2-methylprop-2-enoyloxy)butyl]amino]-1,3,5-triazin-2-yl]-[3-methyl-4-(2-methylprop-2-enoyloxy)butyl]amino]-2-methylbutyl] 2-methylprop-2-enoate.
| Compound Name | [4-[[4,6-bis[bis[3-methyl-4-(2-methylprop-2-enoyloxy)butyl]amino]-1,3,5-triazin-2-yl]-[3-methyl-4-(2-methylprop-2-enoyloxy)butyl]amino]-2-methylbutyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88758316 |
| Molecular Formula | C57H90N6O12 |
| Molecular Weight | 1051.38 g/mol |
| Exact Mass | 1050.66 |
| IUPAC Name | [4-[[4,6-bis[bis[3-methyl-4-(2-methylprop-2-enoyloxy)butyl]amino]-1,3,5-triazin-2-yl]-[3-methyl-4-(2-methylprop-2-enoyloxy)butyl]amino]-2-methylbutyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)CCN(CCC(C)COC(=O)C(=C)C)c1nc(N(CCC(C)COC(=O)C(=C)C)CCC(C)COC(=O)C(=C)C)nc(N(CCC(C)COC(=O)C(=C)C)CCC(C)COC(=O)C(=C)C)n1 |
| InChI | InChI=1S/C57H90N6O12/c1-37(2)49(64)70-31-43(13)19-25-61(26-20-44(14)32-71-50(65)38(3)4)55-58-56(62(27-21-45(15)33-72-51(66)39(5)6)28-22-46(16)34-73-52(67)40(7)8)60-57(59-55)63(29-23-47(17)35-74-53(68)41(9)10)30-24-48(18)36-75-54(69)42(11)12/h43-48H,1,3,5,7,9,11,19-36H2,2,4,6,8,10,12-18H3 |
| InChIKey | QZYNNTUNYFORPE-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 206.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1051.38 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|