C10H22ClNO3 — CID 87121753
N,N-dimethylmethanamine;2-hydroxypropyl 2-methylprop-2-enoate;hydrochloride (PubChem CID 87121753) has the molecular formula C10H22ClNO3 and a molecular weight of 239.74 g/mol. Its IUPAC name is N,N-dimethylmethanamine;2-hydroxypropyl 2-methylprop-2-enoate;hydrochloride.
| Compound Name | N,N-dimethylmethanamine;2-hydroxypropyl 2-methylprop-2-enoate;hydrochloride |
|---|---|
| PubChem CID | 87121753 |
| Molecular Formula | C10H22ClNO3 |
| Molecular Weight | 239.74 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N,N-dimethylmethanamine;2-hydroxypropyl 2-methylprop-2-enoate;hydrochloride |
| SMILES | C=C(C)C(=O)OCC(C)O.CN(C)C.Cl |
| InChI | InChI=1S/C7H12O3.C3H9N.ClH/c1-5(2)7(9)10-4-6(3)8;1-4(2)3;/h6,8H,1,4H2,2-3H3;1-3H3;1H |
| InChIKey | DQCSJGUXTUJMAA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.74 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|