C15H27NO5 — CID 159218034
2-(dimethylamino)ethyl 2-methylprop-2-enoate;2-hydroxypropyl 2-methylprop-2-enoate (PubChem CID 159218034) has the molecular formula C15H27NO5 and a molecular weight of 301.38 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-methylprop-2-enoate;2-hydroxypropyl 2-methylprop-2-enoate.
| Compound Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate;2-hydroxypropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159218034 |
| Molecular Formula | C15H27NO5 |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate;2-hydroxypropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)O.C=C(C)C(=O)OCCN(C)C |
| InChI | InChI=1S/C8H15NO2.C7H12O3/c1-7(2)8(10)11-6-5-9(3)4;1-5(2)7(9)10-4-6(3)8/h1,5-6H2,2-4H3;6,8H,1,4H2,2-3H3 |
| InChIKey | KRIFLOGOXVDMGI-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|