C12H21NO6 — CID 19967472
butanedioic acid;2-(dimethylamino)ethyl 2-methylprop-2-enoate (PubChem CID 19967472) has the molecular formula C12H21NO6 and a molecular weight of 275.30 g/mol. Its IUPAC name is butanedioic acid;2-(dimethylamino)ethyl 2-methylprop-2-enoate.
| Compound Name | butanedioic acid;2-(dimethylamino)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 19967472 |
| Molecular Formula | C12H21NO6 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | butanedioic acid;2-(dimethylamino)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN(C)C.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C8H15NO2.C4H6O4/c1-7(2)8(10)11-6-5-9(3)4;5-3(6)1-2-4(7)8/h1,5-6H2,2-4H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | PZLVZWSOYIJEIC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|