About 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethane;formaldehyde
2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethane;formaldehyde (PubChem CID 142905886) has the molecular formula C11H23NO3
and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethane;formaldehyde.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethane;formaldehyde |
| PubChem CID | 142905886 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethane;formaldehyde |
| SMILES | C=C(C)C(=O)OCCN(C)C.C=O.CC |
| InChI | InChI=1S/C8H15NO2.C2H6.CH2O/c1-7(2)8(10)11-6-5-9(3)4;2*1-2/h1,5-6H2,2-4H3;1-2H3;1H2 |
| InChIKey | BSKIJNQDMOJCRJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethane;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethane;formaldehyde?
The IUPAC name of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethane;formaldehyde (CID 142905886) is 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethane;formaldehyde.
What is the SMILES notation for 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethane;formaldehyde?
The canonical SMILES for 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethane;formaldehyde is C=C(C)C(=O)OCCN(C)C.C=O.CC.
What is the InChIKey of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethane;formaldehyde?
The InChIKey is BSKIJNQDMOJCRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.C2H6.CH2O/c1-7(2)8(10)11-6-5-9(3)4;2*1-2/h1,5-6H2,2-4H3;1-2H3;1H2.
What are the key properties of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethane;formaldehyde?
2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethane;formaldehyde has a molecular weight of 217.31 g/mol, XLogP of 1.51, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethane;formaldehyde is sourced from PubChem (CID 142905886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).