About 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethanamine;hydrobromide
2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethanamine;hydrobromide (PubChem CID 175228289) has the molecular formula C10H23BrN2O2
and a molecular weight of 283.21 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethanamine;hydrobromide.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethanamine;hydrobromide |
| PubChem CID | 175228289 |
| Molecular Formula | C10H23BrN2O2 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethanamine;hydrobromide |
| SMILES | Br.C=C(C)C(=O)OCCN(C)C.CCN |
| InChI | InChI=1S/C8H15NO2.C2H7N.BrH/c1-7(2)8(10)11-6-5-9(3)4;1-2-3;/h1,5-6H2,2-4H3;2-3H2,1H3;1H |
| InChIKey | SGYHMEJHKBUNEG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethanamine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethanamine;hydrobromide?
The IUPAC name of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethanamine;hydrobromide (CID 175228289) is 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethanamine;hydrobromide.
What is the SMILES notation for 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethanamine;hydrobromide?
The canonical SMILES for 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethanamine;hydrobromide is Br.C=C(C)C(=O)OCCN(C)C.CCN.
What is the InChIKey of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethanamine;hydrobromide?
The InChIKey is SGYHMEJHKBUNEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.C2H7N.BrH/c1-7(2)8(10)11-6-5-9(3)4;1-2-3;/h1,5-6H2,2-4H3;2-3H2,1H3;1H.
What are the key properties of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethanamine;hydrobromide?
2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethanamine;hydrobromide has a molecular weight of 283.21 g/mol, XLogP of 1.21, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethanamine;hydrobromide is sourced from PubChem (CID 175228289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).