About 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl 2-hydroxyprop-2-enoate
2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl 2-hydroxyprop-2-enoate (PubChem CID 174893121) has the molecular formula C13H23NO5
and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl 2-hydroxyprop-2-enoate.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl 2-hydroxyprop-2-enoate |
| PubChem CID | 174893121 |
| Molecular Formula | C13H23NO5 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl 2-hydroxyprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN(C)C.C=C(O)C(=O)OCC |
| InChI | InChI=1S/C8H15NO2.C5H8O3/c1-7(2)8(10)11-6-5-9(3)4;1-3-8-5(7)4(2)6/h1,5-6H2,2-4H3;6H,2-3H2,1H3 |
| InChIKey | CEQLCHKASXTCRT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl 2-hydroxyprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl 2-hydroxyprop-2-enoate?
The IUPAC name of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl 2-hydroxyprop-2-enoate (CID 174893121) is 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl 2-hydroxyprop-2-enoate.
What is the SMILES notation for 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl 2-hydroxyprop-2-enoate?
The canonical SMILES for 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl 2-hydroxyprop-2-enoate is C=C(C)C(=O)OCCN(C)C.C=C(O)C(=O)OCC.
What is the InChIKey of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl 2-hydroxyprop-2-enoate?
The InChIKey is CEQLCHKASXTCRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.C5H8O3/c1-7(2)8(10)11-6-5-9(3)4;1-3-8-5(7)4(2)6/h1,5-6H2,2-4H3;6H,2-3H2,1H3.
What are the key properties of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl 2-hydroxyprop-2-enoate?
2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl 2-hydroxyprop-2-enoate has a molecular weight of 273.33 g/mol, XLogP of 1.29, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl 2-hydroxyprop-2-enoate is sourced from PubChem (CID 174893121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).