About 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl acetate
2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl acetate (PubChem CID 131725052) has the molecular formula C12H23NO4
and a molecular weight of 245.32 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl acetate.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl acetate |
| PubChem CID | 131725052 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl acetate |
| SMILES | C=C(C)C(=O)OCCN(C)C.CCOC(C)=O |
| InChI | InChI=1S/C8H15NO2.C4H8O2/c1-7(2)8(10)11-6-5-9(3)4;1-3-6-4(2)5/h1,5-6H2,2-4H3;3H2,1-2H3 |
| InChIKey | BAOZUVVRRWNLMT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl acetate?
The IUPAC name of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl acetate (CID 131725052) is 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl acetate.
What is the SMILES notation for 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl acetate?
The canonical SMILES for 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl acetate is C=C(C)C(=O)OCCN(C)C.CCOC(C)=O.
What is the InChIKey of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl acetate?
The InChIKey is BAOZUVVRRWNLMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.C4H8O2/c1-7(2)8(10)11-6-5-9(3)4;1-3-6-4(2)5/h1,5-6H2,2-4H3;3H2,1-2H3.
What are the key properties of 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl acetate?
2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl acetate has a molecular weight of 245.32 g/mol, XLogP of 1.24, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 2-methylprop-2-enoate;ethyl acetate is sourced from PubChem (CID 131725052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).