About azane;4-(dimethylamino)butyl 2-methylprop-2-enoate;hydrochloride
azane;4-(dimethylamino)butyl 2-methylprop-2-enoate;hydrochloride (PubChem CID 174828907) has the molecular formula C10H23ClN2O2
and a molecular weight of 238.76 g/mol. Its IUPAC name is azane;4-(dimethylamino)butyl 2-methylprop-2-enoate;hydrochloride.
Molecular Properties
| Compound Name | azane;4-(dimethylamino)butyl 2-methylprop-2-enoate;hydrochloride |
| PubChem CID | 174828907 |
| Molecular Formula | C10H23ClN2O2 |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | azane;4-(dimethylamino)butyl 2-methylprop-2-enoate;hydrochloride |
| SMILES | C=C(C)C(=O)OCCCCN(C)C.Cl.N |
| InChI | InChI=1S/C10H19NO2.ClH.H3N/c1-9(2)10(12)13-8-6-5-7-11(3)4;;/h1,5-8H2,2-4H3;1H;1H3 |
| InChIKey | BYTMLGXOCFYEDQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 64.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azane;4-(dimethylamino)butyl 2-methylprop-2-enoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;4-(dimethylamino)butyl 2-methylprop-2-enoate;hydrochloride?
The IUPAC name of azane;4-(dimethylamino)butyl 2-methylprop-2-enoate;hydrochloride (CID 174828907) is azane;4-(dimethylamino)butyl 2-methylprop-2-enoate;hydrochloride.
What is the SMILES notation for azane;4-(dimethylamino)butyl 2-methylprop-2-enoate;hydrochloride?
The canonical SMILES for azane;4-(dimethylamino)butyl 2-methylprop-2-enoate;hydrochloride is C=C(C)C(=O)OCCCCN(C)C.Cl.N.
What is the InChIKey of azane;4-(dimethylamino)butyl 2-methylprop-2-enoate;hydrochloride?
The InChIKey is BYTMLGXOCFYEDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2.ClH.H3N/c1-9(2)10(12)13-8-6-5-7-11(3)4;;/h1,5-8H2,2-4H3;1H;1H3.
What are the key properties of azane;4-(dimethylamino)butyl 2-methylprop-2-enoate;hydrochloride?
azane;4-(dimethylamino)butyl 2-methylprop-2-enoate;hydrochloride has a molecular weight of 238.76 g/mol, XLogP of 2.03, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;4-(dimethylamino)butyl 2-methylprop-2-enoate;hydrochloride is sourced from PubChem (CID 174828907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).