C18H34N2O4 — CID 158407090
6-(dimethylamino)-2-methylhex-2-enoic acid;3-(dimethylamino)propyl 2-methylprop-2-enoate (PubChem CID 158407090) has the molecular formula C18H34N2O4 and a molecular weight of 342.48 g/mol. Its IUPAC name is 6-(dimethylamino)-2-methylhex-2-enoic acid;3-(dimethylamino)propyl 2-methylprop-2-enoate.
| Compound Name | 6-(dimethylamino)-2-methylhex-2-enoic acid;3-(dimethylamino)propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158407090 |
| Molecular Formula | C18H34N2O4 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | 6-(dimethylamino)-2-methylhex-2-enoic acid;3-(dimethylamino)propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCN(C)C.CC(=CCCCN(C)C)C(=O)O |
| InChI | InChI=1S/2C9H17NO2/c1-8(2)9(11)12-7-5-6-10(3)4;1-8(9(11)12)6-4-5-7-10(2)3/h1,5-7H2,2-4H3;6H,4-5,7H2,1-3H3,(H,11,12) |
| InChIKey | GYVJMQNTUKGVES-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|