C23H46O10Si2 — CID 162204652
2-methyl-6-trimethoxysilylhex-2-enoic acid;3-triethoxysilylpropyl 2-methylprop-2-enoate (PubChem CID 162204652) has the molecular formula C23H46O10Si2 and a molecular weight of 538.78 g/mol. Its IUPAC name is 2-methyl-6-trimethoxysilylhex-2-enoic acid;3-triethoxysilylpropyl 2-methylprop-2-enoate.
| Compound Name | 2-methyl-6-trimethoxysilylhex-2-enoic acid;3-triethoxysilylpropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 162204652 |
| Molecular Formula | C23H46O10Si2 |
| Molecular Weight | 538.78 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | 2-methyl-6-trimethoxysilylhex-2-enoic acid;3-triethoxysilylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](OCC)(OCC)OCC.CO[Si](CCCC=C(C)C(=O)O)(OC)OC |
| InChI | InChI=1S/C13H26O5Si.C10H20O5Si/c1-6-16-19(17-7-2,18-8-3)11-9-10-15-13(14)12(4)5;1-9(10(11)12)7-5-6-8-16(13-2,14-3)15-4/h4,6-11H2,1-3,5H3;7H,5-6,8H2,1-4H3,(H,11,12) |
| InChIKey | ZSAKGZXLOOALEW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.78 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|