C22H40O4 — CID 159623260
heptyl 2-methylprop-2-enoate;2-methyldec-2-enoic acid (PubChem CID 159623260) has the molecular formula C22H40O4 and a molecular weight of 368.56 g/mol. Its IUPAC name is heptyl 2-methylprop-2-enoate;2-methyldec-2-enoic acid.
| Compound Name | heptyl 2-methylprop-2-enoate;2-methyldec-2-enoic acid |
|---|---|
| PubChem CID | 159623260 |
| Molecular Formula | C22H40O4 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | heptyl 2-methylprop-2-enoate;2-methyldec-2-enoic acid |
| SMILES | C=C(C)C(=O)OCCCCCCC.CCCCCCCC=C(C)C(=O)O |
| InChI | InChI=1S/2C11H20O2/c1-4-5-6-7-8-9-13-11(12)10(2)3;1-3-4-5-6-7-8-9-10(2)11(12)13/h2,4-9H2,1,3H3;9H,3-8H2,1-2H3,(H,12,13) |
| InChIKey | MODWQJOSODMPPU-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|