heptyl 2-methylprop-2-enoate;2-methyldec-2-enoic acid

C22H40O4 — CID 159623260

IUPACheptyl 2-methylprop-2-enoate;2-methyldec-2-enoic acid
SMILESC=C(C)C(=O)OCCCCCCC.CCCCCCCC=C(C)C(=O)O
InChIInChI=1S/2C11H20O2/c1-4-5-6-7-8-9-13-11(12)10(2)3;1-3-4-5-6-7-8-9-10(2)11(12)13/h2,4-9H2,1,3H3;9H,3-8H2,1-2H3,(H,12,13)
InChIKeyMODWQJOSODMPPU-UHFFFAOYSA-N
MW368.56 g/mol
LogP6.45
Rot. Bonds14

About heptyl 2-methylprop-2-enoate;2-methyldec-2-enoic acid

heptyl 2-methylprop-2-enoate;2-methyldec-2-enoic acid (PubChem CID 159623260) has the molecular formula C22H40O4 and a molecular weight of 368.56 g/mol. Its IUPAC name is heptyl 2-methylprop-2-enoate;2-methyldec-2-enoic acid.

Molecular Properties

Compound Nameheptyl 2-methylprop-2-enoate;2-methyldec-2-enoic acid
PubChem CID159623260
Molecular FormulaC22H40O4
Molecular Weight368.56 g/mol
Exact Mass368.29
IUPAC Nameheptyl 2-methylprop-2-enoate;2-methyldec-2-enoic acid
SMILESC=C(C)C(=O)OCCCCCCC.CCCCCCCC=C(C)C(=O)O
InChIInChI=1S/2C11H20O2/c1-4-5-6-7-8-9-13-11(12)10(2)3;1-3-4-5-6-7-8-9-10(2)11(12)13/h2,4-9H2,1,3H3;9H,3-8H2,1-2H3,(H,12,13)
InChIKeyMODWQJOSODMPPU-UHFFFAOYSA-N
XLogP6.45
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds14
Heavy Atoms26
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500368.56
LogP ≤ 56.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze heptyl 2-methylprop-2-enoate;2-methyldec-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of heptyl 2-methylprop-2-enoate;2-methyldec-2-enoic acid?
The IUPAC name of heptyl 2-methylprop-2-enoate;2-methyldec-2-enoic acid (CID 159623260) is heptyl 2-methylprop-2-enoate;2-methyldec-2-enoic acid.
What is the SMILES notation for heptyl 2-methylprop-2-enoate;2-methyldec-2-enoic acid?
The canonical SMILES for heptyl 2-methylprop-2-enoate;2-methyldec-2-enoic acid is C=C(C)C(=O)OCCCCCCC.CCCCCCCC=C(C)C(=O)O.
What is the InChIKey of heptyl 2-methylprop-2-enoate;2-methyldec-2-enoic acid?
The InChIKey is MODWQJOSODMPPU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H20O2/c1-4-5-6-7-8-9-13-11(12)10(2)3;1-3-4-5-6-7-8-9-10(2)11(12)13/h2,4-9H2,1,3H3;9H,3-8H2,1-2H3,(H,12,13).
What are the key properties of heptyl 2-methylprop-2-enoate;2-methyldec-2-enoic acid?
heptyl 2-methylprop-2-enoate;2-methyldec-2-enoic acid has a molecular weight of 368.56 g/mol, XLogP of 6.45, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for heptyl 2-methylprop-2-enoate;2-methyldec-2-enoic acid is sourced from PubChem (CID 159623260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).