C22H40O2 — CID 6436390
[(Z)-octadec-9-enyl] 2-methylprop-2-enoate (PubChem CID 6436390) has the molecular formula C22H40O2 and a molecular weight of 336.56 g/mol. Its IUPAC name is [(Z)-octadec-9-enyl] 2-methylprop-2-enoate.
| Compound Name | [(Z)-octadec-9-enyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 6436390 |
| Molecular Formula | C22H40O2 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.30 |
| IUPAC Name | [(Z)-octadec-9-enyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C22H40O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-22(23)21(2)3/h11-12H,2,4-10,13-20H2,1,3H3/b12-11- |
| InChIKey | BXOBFMUWVVHLFK-QXMHVHEDSA-N |
| XLogP | 7.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|