About heptyl 2-methylundec-2-enoate
heptyl 2-methylundec-2-enoate (PubChem CID 174231744) has the molecular formula C19H36O2
and a molecular weight of 296.50 g/mol. Its IUPAC name is heptyl 2-methylundec-2-enoate.
Molecular Properties
| Compound Name | heptyl 2-methylundec-2-enoate |
| PubChem CID | 174231744 |
| Molecular Formula | C19H36O2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | heptyl 2-methylundec-2-enoate |
| SMILES | CCCCCCCCC=C(C)C(=O)OCCCCCCC |
| InChI | InChI=1S/C19H36O2/c1-4-6-8-10-11-12-14-16-18(3)19(20)21-17-15-13-9-7-5-2/h16H,4-15,17H2,1-3H3 |
| InChIKey | BVNATNJYVQURKJ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze heptyl 2-methylundec-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptyl 2-methylundec-2-enoate?
The IUPAC name of heptyl 2-methylundec-2-enoate (CID 174231744) is heptyl 2-methylundec-2-enoate.
What is the SMILES notation for heptyl 2-methylundec-2-enoate?
The canonical SMILES for heptyl 2-methylundec-2-enoate is CCCCCCCCC=C(C)C(=O)OCCCCCCC.
What is the InChIKey of heptyl 2-methylundec-2-enoate?
The InChIKey is BVNATNJYVQURKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O2/c1-4-6-8-10-11-12-14-16-18(3)19(20)21-17-15-13-9-7-5-2/h16H,4-15,17H2,1-3H3.
What are the key properties of heptyl 2-methylundec-2-enoate?
heptyl 2-methylundec-2-enoate has a molecular weight of 296.50 g/mol, XLogP of 6.20, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for heptyl 2-methylundec-2-enoate is sourced from PubChem (CID 174231744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).