About 2-methyl-6-trimethoxysilylhex-2-enoic acid;sulfane
2-methyl-6-trimethoxysilylhex-2-enoic acid;sulfane (PubChem CID 173006687) has the molecular formula C10H22O5SSi
and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-methyl-6-trimethoxysilylhex-2-enoic acid;sulfane.
Molecular Properties
| Compound Name | 2-methyl-6-trimethoxysilylhex-2-enoic acid;sulfane |
| PubChem CID | 173006687 |
| Molecular Formula | C10H22O5SSi |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-methyl-6-trimethoxysilylhex-2-enoic acid;sulfane |
| SMILES | CO[Si](CCCC=C(C)C(=O)O)(OC)OC.S |
| InChI | InChI=1S/C10H20O5Si.H2S/c1-9(10(11)12)7-5-6-8-16(13-2,14-3)15-4;/h7H,5-6,8H2,1-4H3,(H,11,12);1H2 |
| InChIKey | PAWVOPFXQNMUJZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-6-trimethoxysilylhex-2-enoic acid;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-trimethoxysilylhex-2-enoic acid;sulfane?
The IUPAC name of 2-methyl-6-trimethoxysilylhex-2-enoic acid;sulfane (CID 173006687) is 2-methyl-6-trimethoxysilylhex-2-enoic acid;sulfane.
What is the SMILES notation for 2-methyl-6-trimethoxysilylhex-2-enoic acid;sulfane?
The canonical SMILES for 2-methyl-6-trimethoxysilylhex-2-enoic acid;sulfane is CO[Si](CCCC=C(C)C(=O)O)(OC)OC.S.
What is the InChIKey of 2-methyl-6-trimethoxysilylhex-2-enoic acid;sulfane?
The InChIKey is PAWVOPFXQNMUJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O5Si.H2S/c1-9(10(11)12)7-5-6-8-16(13-2,14-3)15-4;/h7H,5-6,8H2,1-4H3,(H,11,12);1H2.
What are the key properties of 2-methyl-6-trimethoxysilylhex-2-enoic acid;sulfane?
2-methyl-6-trimethoxysilylhex-2-enoic acid;sulfane has a molecular weight of 282.43 g/mol, XLogP of 1.79, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-trimethoxysilylhex-2-enoic acid;sulfane is sourced from PubChem (CID 173006687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).