C28H74O11Si10 — CID 57280861
2-methyl-6-tris[[methyl-bis(trimethylsilyloxy)silyl]oxy]silylhex-2-enoic acid (PubChem CID 57280861) has the molecular formula C28H74O11Si10 and a molecular weight of 867.75 g/mol. Its IUPAC name is 2-methyl-6-tris[[methyl-bis(trimethylsilyloxy)silyl]oxy]silylhex-2-enoic acid.
| Compound Name | 2-methyl-6-tris[[methyl-bis(trimethylsilyloxy)silyl]oxy]silylhex-2-enoic acid |
|---|---|
| PubChem CID | 57280861 |
| Molecular Formula | C28H74O11Si10 |
| Molecular Weight | 867.75 g/mol |
| Exact Mass | 866.29 |
| IUPAC Name | 2-methyl-6-tris[[methyl-bis(trimethylsilyloxy)silyl]oxy]silylhex-2-enoic acid |
| SMILES | CC(=CCCC[Si](O[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)(O[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)C(=O)O |
| InChI | InChI=1S/C28H74O11Si10/c1-27(28(29)30)25-23-24-26-49(37-46(20,31-40(2,3)4)32-41(5,6)7,38-47(21,33-42(8,9)10)34-43(11,12)13)39-48(22,35-44(14,15)16)36-45(17,18)19/h25H,23-24,26H2,1-22H3,(H,29,30) |
| InChIKey | KLNKQCDINBOLDC-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.75 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|