methane;2-methyl-6-silylhex-2-enoic acid

C9H22O2Si — CID 173490194

IUPACmethane;2-methyl-6-silylhex-2-enoic acid
SMILESC.C.CC(=CCCC[SiH3])C(=O)O
InChIInChI=1S/C7H14O2Si.2CH4/c1-6(7(8)9)4-2-3-5-10;;/h4H,2-3,5H2,1,10H3,(H,8,9);2*1H4
InChIKeyLQWKLIBSBKSSDA-UHFFFAOYSA-N
MW190.36 g/mol
LogP1.85
Rot. Bonds4

About methane;2-methyl-6-silylhex-2-enoic acid

methane;2-methyl-6-silylhex-2-enoic acid (PubChem CID 173490194) has the molecular formula C9H22O2Si and a molecular weight of 190.36 g/mol. Its IUPAC name is methane;2-methyl-6-silylhex-2-enoic acid.

Molecular Properties

Compound Namemethane;2-methyl-6-silylhex-2-enoic acid
PubChem CID173490194
Molecular FormulaC9H22O2Si
Molecular Weight190.36 g/mol
Exact Mass190.14
IUPAC Namemethane;2-methyl-6-silylhex-2-enoic acid
SMILESC.C.CC(=CCCC[SiH3])C(=O)O
InChIInChI=1S/C7H14O2Si.2CH4/c1-6(7(8)9)4-2-3-5-10;;/h4H,2-3,5H2,1,10H3,(H,8,9);2*1H4
InChIKeyLQWKLIBSBKSSDA-UHFFFAOYSA-N
XLogP1.85
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.36
LogP ≤ 51.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methane;2-methyl-6-silylhex-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2,13-dimethyltetradeca-2,12-dienedioic acid
CID 173279289
(E)-7-bromo-2-methylhept-2-enoic acid
CID 87183825
(Z)-2-methylnon-2-enoic acid
CID 19098031
(E)-2-methylnonacos-2-enoic acid
CID 87108662
2-methylhentriacont-2-enoic acid
CID 141160211
2-methylheptadec-2-enoic acid;hydrofluoride
CID 174883773
(E)-2-methylnon-2-enedioic acid
CID 87072449
8-amino-2-methyloct-2-enoic acid
CID 90963841
6-hydroxy-2-methylhex-2-enoic acid;2-methylpent-2-enoic acid
CID 173373377
2-methyl-6-sulfohex-2-enoic acid
CID 53446312
(E)-6-ethoxy-2-methylhex-2-enoic acid
CID 87120210
2-methyl-6-sulfinohex-2-enoic acid
CID 91087670

Frequently Asked Questions

What is the IUPAC name of methane;2-methyl-6-silylhex-2-enoic acid?
The IUPAC name of methane;2-methyl-6-silylhex-2-enoic acid (CID 173490194) is methane;2-methyl-6-silylhex-2-enoic acid.
What is the SMILES notation for methane;2-methyl-6-silylhex-2-enoic acid?
The canonical SMILES for methane;2-methyl-6-silylhex-2-enoic acid is C.C.CC(=CCCC[SiH3])C(=O)O.
What is the InChIKey of methane;2-methyl-6-silylhex-2-enoic acid?
The InChIKey is LQWKLIBSBKSSDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2Si.2CH4/c1-6(7(8)9)4-2-3-5-10;;/h4H,2-3,5H2,1,10H3,(H,8,9);2*1H4.
What are the key properties of methane;2-methyl-6-silylhex-2-enoic acid?
methane;2-methyl-6-silylhex-2-enoic acid has a molecular weight of 190.36 g/mol, XLogP of 1.85, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methyl-6-silylhex-2-enoic acid is sourced from PubChem (CID 173490194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).