About methane;2-methyl-6-silylhex-2-enoic acid
methane;2-methyl-6-silylhex-2-enoic acid (PubChem CID 173490194) has the molecular formula C9H22O2Si
and a molecular weight of 190.36 g/mol. Its IUPAC name is methane;2-methyl-6-silylhex-2-enoic acid.
Molecular Properties
| Compound Name | methane;2-methyl-6-silylhex-2-enoic acid |
| PubChem CID | 173490194 |
| Molecular Formula | C9H22O2Si |
| Molecular Weight | 190.36 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | methane;2-methyl-6-silylhex-2-enoic acid |
| SMILES | C.C.CC(=CCCC[SiH3])C(=O)O |
| InChI | InChI=1S/C7H14O2Si.2CH4/c1-6(7(8)9)4-2-3-5-10;;/h4H,2-3,5H2,1,10H3,(H,8,9);2*1H4 |
| InChIKey | LQWKLIBSBKSSDA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methane;2-methyl-6-silylhex-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-methyl-6-silylhex-2-enoic acid?
The IUPAC name of methane;2-methyl-6-silylhex-2-enoic acid (CID 173490194) is methane;2-methyl-6-silylhex-2-enoic acid.
What is the SMILES notation for methane;2-methyl-6-silylhex-2-enoic acid?
The canonical SMILES for methane;2-methyl-6-silylhex-2-enoic acid is C.C.CC(=CCCC[SiH3])C(=O)O.
What is the InChIKey of methane;2-methyl-6-silylhex-2-enoic acid?
The InChIKey is LQWKLIBSBKSSDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2Si.2CH4/c1-6(7(8)9)4-2-3-5-10;;/h4H,2-3,5H2,1,10H3,(H,8,9);2*1H4.
What are the key properties of methane;2-methyl-6-silylhex-2-enoic acid?
methane;2-methyl-6-silylhex-2-enoic acid has a molecular weight of 190.36 g/mol, XLogP of 1.85, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methyl-6-silylhex-2-enoic acid is sourced from PubChem (CID 173490194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).