C28H68O10Si8 — CID 54305783
2,3-bis[3-tris(trimethylsilyloxy)silylpropyl]but-2-enedioic acid (PubChem CID 54305783) has the molecular formula C28H68O10Si8 and a molecular weight of 789.53 g/mol. Its IUPAC name is 2,3-bis[3-tris(trimethylsilyloxy)silylpropyl]but-2-enedioic acid.
| Compound Name | 2,3-bis[3-tris(trimethylsilyloxy)silylpropyl]but-2-enedioic acid |
|---|---|
| PubChem CID | 54305783 |
| Molecular Formula | C28H68O10Si8 |
| Molecular Weight | 789.53 g/mol |
| Exact Mass | 788.30 |
| IUPAC Name | 2,3-bis[3-tris(trimethylsilyloxy)silylpropyl]but-2-enedioic acid |
| SMILES | C[Si](C)(C)O[Si](CCCC(C(=O)O)=C(CCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C)C(=O)O)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C28H68O10Si8/c1-39(2,3)33-45(34-40(4,5)6,35-41(7,8)9)23-19-21-25(27(29)30)26(28(31)32)22-20-24-46(36-42(10,11)12,37-43(13,14)15)38-44(16,17)18/h19-24H2,1-18H3,(H,29,30)(H,31,32) |
| InChIKey | SHJRRJGQGJVNLG-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.53 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|